C12H17N3O8 — CID 10853956
methyl (2R,3R,4S)-4-acetyloxy-3-azido-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 10853956) has the molecular formula C12H17N3O8 and a molecular weight of 331.28 g/mol. Its IUPAC name is methyl (2R,3R,4S)-4-acetyloxy-3-azido-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-4-acetyloxy-3-azido-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 10853956 |
| Molecular Formula | C12H17N3O8 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | methyl (2R,3R,4S)-4-acetyloxy-3-azido-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C12H17N3O8/c1-5(17)22-7-3-8(12(20)21-2)23-11(9(7)14-15-13)10(19)6(18)4-16/h3,6-7,9-11,16,18-19H,4H2,1-2H3/t6-,7+,9-,10-,11-/m1/s1 |
| InChIKey | DNGLMARUPXMRCO-XKLWRSMXSA-N |
| XLogP | -1.23 |
| TPSA | 171.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|