C12H17N4O8- — CID 172675845
(2R,3R,4S)-4-azido-3-(2-hydroxypropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 172675845) has the molecular formula C12H17N4O8- and a molecular weight of 345.29 g/mol. Its IUPAC name is (2R,3R,4S)-4-azido-3-(2-hydroxypropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | (2R,3R,4S)-4-azido-3-(2-hydroxypropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 172675845 |
| Molecular Formula | C12H17N4O8- |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (2R,3R,4S)-4-azido-3-(2-hydroxypropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CC(O)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)[O-])=C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C12H18N4O8/c1-4(18)11(21)14-8-5(15-16-13)2-7(12(22)23)24-10(8)9(20)6(19)3-17/h2,4-6,8-10,17-20H,3H2,1H3,(H,14,21)(H,22,23)/p-1/t4?,5-,6+,8+,9+,10+/m0/s1 |
| InChIKey | GOBIAHRGBPELBY-PHHJDJDLSA-M |
| XLogP | -3.72 |
| TPSA | 208.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|