C14H19N4NaO7 — CID 118713243
sodium (2R,3R,4S)-4-azido-3-[[(E)-2-methylbut-2-enoyl]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 118713243) has the molecular formula C14H19N4NaO7 and a molecular weight of 378.32 g/mol. Its IUPAC name is sodium (2R,3R,4S)-4-azido-3-[[(E)-2-methylbut-2-enoyl]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | sodium (2R,3R,4S)-4-azido-3-[[(E)-2-methylbut-2-enoyl]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 118713243 |
| Molecular Formula | C14H19N4NaO7 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | sodium (2R,3R,4S)-4-azido-3-[[(E)-2-methylbut-2-enoyl]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | C/C=C(\C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)[O-])=C[C@@H]1N=[N+]=[N-].[Na+] |
| InChI | InChI=1S/C14H20N4O7.Na/c1-3-6(2)13(22)16-10-7(17-18-15)4-9(14(23)24)25-12(10)11(21)8(20)5-19;/h3-4,7-8,10-12,19-21H,5H2,1-2H3,(H,16,22)(H,23,24);/q;+1/p-1/b6-3+;/t7-,8+,10+,11+,12+;/m0./s1 |
| InChIKey | VVXARWGOKNNCMC-LMBZMYCMSA-M |
| XLogP | -5.13 |
| TPSA | 187.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | -5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|