C14H23N4NaO7 — CID 118713238
sodium (2R,3R,4S)-4-(diaminomethylideneamino)-3-(2-methylpropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 118713238) has the molecular formula C14H23N4NaO7 and a molecular weight of 382.35 g/mol. Its IUPAC name is sodium (2R,3R,4S)-4-(diaminomethylideneamino)-3-(2-methylpropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | sodium (2R,3R,4S)-4-(diaminomethylideneamino)-3-(2-methylpropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 118713238 |
| Molecular Formula | C14H23N4NaO7 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | sodium (2R,3R,4S)-4-(diaminomethylideneamino)-3-(2-methylpropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)[O-])=C[C@@H]1N=C(N)N.[Na+] |
| InChI | InChI=1S/C14H24N4O7.Na/c1-5(2)12(22)18-9-6(17-14(15)16)3-8(13(23)24)25-11(9)10(21)7(20)4-19;/h3,5-7,9-11,19-21H,4H2,1-2H3,(H,18,22)(H,23,24)(H4,15,16,17);/q;+1/p-1/t6-,7+,9+,10+,11+;/m0./s1 |
| InChIKey | VOUGLQHOYJXIGV-WWIZLJSCSA-M |
| XLogP | -7.48 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | -7.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|