C16H28N4O7 — CID 172875223
4-(diaminomethylideneamino)-3-(4-methylpentanoylamino)-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 172875223) has the molecular formula C16H28N4O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-3-(4-methylpentanoylamino)-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | 4-(diaminomethylideneamino)-3-(4-methylpentanoylamino)-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 172875223 |
| Molecular Formula | C16H28N4O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-(diaminomethylideneamino)-3-(4-methylpentanoylamino)-2-(1,2,3-trihydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(C)CCC(=O)NC1C(N=C(N)N)C=C(C(=O)O)OC1C(O)C(O)CO |
| InChI | InChI=1S/C16H28N4O7/c1-7(2)3-4-11(23)20-12-8(19-16(17)18)5-10(15(25)26)27-14(12)13(24)9(22)6-21/h5,7-9,12-14,21-22,24H,3-4,6H2,1-2H3,(H,20,23)(H,25,26)(H4,17,18,19) |
| InChIKey | CGSNXPGJUHSVOX-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 200.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|