C10H17AcN4O6- — CID 59051033
actinium;[(2R,3R,4S)-6-carboxy-4-(diaminomethylideneamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]azanide (PubChem CID 59051033) has the molecular formula C10H17AcN4O6- and a molecular weight of 516.27 g/mol. Its IUPAC name is actinium;[(2R,3R,4S)-6-carboxy-4-(diaminomethylideneamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]azanide.
| Compound Name | actinium;[(2R,3R,4S)-6-carboxy-4-(diaminomethylideneamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]azanide |
|---|---|
| PubChem CID | 59051033 |
| Molecular Formula | C10H17AcN4O6- |
| Molecular Weight | 516.27 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | actinium;[(2R,3R,4S)-6-carboxy-4-(diaminomethylideneamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-3-yl]azanide |
| SMILES | [Ac].[NH-][C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C10H17N4O6.Ac/c11-6-3(14-10(12)13)1-5(9(18)19)20-8(6)7(17)4(16)2-15;/h1,3-4,6-8,11,15-17H,2H2,(H,18,19)(H4,12,13,14);/q-1;/t3-,4+,6+,7+,8+;/m0./s1 |
| InChIKey | VCCPDFZTVBKXIU-AFJOUCPTSA-N |
| XLogP | -2.87 |
| TPSA | 195.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.27 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|