C14H21N5O8 — CID 10834076
(2R,3R,4S)-3-acetamido-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-(2-imino-2-methoxyethoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 10834076) has the molecular formula C14H21N5O8 and a molecular weight of 387.35 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-(2-imino-2-methoxyethoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-(2-imino-2-methoxyethoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 10834076 |
| Molecular Formula | C14H21N5O8 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-(2-imino-2-methoxyethoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | [H]/N=C(/CO[C@H]1C=C(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CN=[N+]=[N-])[C@@H]1NC(C)=O)OC |
| InChI | InChI=1S/C14H21N5O8/c1-6(20)18-11-8(26-5-10(15)25-2)3-9(14(23)24)27-13(11)12(22)7(21)4-17-19-16/h3,7-8,11-13,15,21-22H,4-5H2,1-2H3,(H,18,20)(H,23,24)/b15-10-/t7-,8+,11-,12-,13-/m1/s1 |
| InChIKey | OXTBDIZIYHRUIM-CYGUNSDXSA-N |
| XLogP | -1.10 |
| TPSA | 207.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|