C22H36N4O8 — CID 175984651
methyl (2R,5S,6R)-6-[(4R,5R)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-4-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enyloxane-2-carboxylate (PubChem CID 175984651) has the molecular formula C22H36N4O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is methyl (2R,5S,6R)-6-[(4R,5R)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-4-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enyloxane-2-carboxylate.
| Compound Name | methyl (2R,5S,6R)-6-[(4R,5R)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-4-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enyloxane-2-carboxylate |
|---|---|
| PubChem CID | 175984651 |
| Molecular Formula | C22H36N4O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | methyl (2R,5S,6R)-6-[(4R,5R)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-4-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enyloxane-2-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)CC(C)(O)[C@@H](NC(=O)OC(C)(C)C)[C@H]([C@@H]2OC(C)(C)O[C@@H]2CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C22H36N4O8/c1-9-10-22(17(27)30-8)12-21(7,29)16(25-18(28)34-19(2,3)4)15(33-22)14-13(11-24-26-23)31-20(5,6)32-14/h9,13-16,29H,1,10-12H2,2-8H3,(H,25,28)/t13-,14-,15+,16+,21?,22-/m1/s1 |
| InChIKey | QZISIHAIOLCDBY-RGDUTVOLSA-N |
| XLogP | 2.74 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|