C11H19NO9 — CID 23829201
methyl 5-formamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 23829201) has the molecular formula C11H19NO9 and a molecular weight of 309.27 g/mol. Its IUPAC name is methyl 5-formamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl 5-formamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 23829201 |
| Molecular Formula | C11H19NO9 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | methyl 5-formamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)C1(O)CC(O)C(NC=O)C([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C11H19NO9/c1-20-10(18)11(19)2-5(15)7(12-4-14)9(21-11)8(17)6(16)3-13/h4-9,13,15-17,19H,2-3H2,1H3,(H,12,14)/t5?,6-,7?,8-,9?,11?/m1/s1 |
| InChIKey | VOQNSKPHOCQUGP-NTZLIZPOSA-N |
| XLogP | -4.17 |
| TPSA | 165.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|