C19H31NO11S — CID 164574926
methyl (2S,4S,5R,6R)-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-[2-(2-prop-2-ynoxyethoxy)ethylsulfanyl]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 164574926) has the molecular formula C19H31NO11S and a molecular weight of 481.52 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-[2-(2-prop-2-ynoxyethoxy)ethylsulfanyl]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-[2-(2-prop-2-ynoxyethoxy)ethylsulfanyl]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 164574926 |
| Molecular Formula | C19H31NO11S |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | methyl (2S,4S,5R,6R)-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-[2-(2-prop-2-ynoxyethoxy)ethylsulfanyl]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | C#CCOCCOCCS[C@]1(C(=O)OC)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C19H31NO11S/c1-3-4-29-5-6-30-7-8-32-19(18(27)28-2)9-12(23)15(20-14(25)11-22)17(31-19)16(26)13(24)10-21/h1,12-13,15-17,21-24,26H,4-11H2,2H3,(H,20,25)/t12-,13+,15+,16+,17+,19-/m0/s1 |
| InChIKey | CMVMJYWQDDYTOW-OXSFYUKISA-N |
| XLogP | -3.40 |
| TPSA | 184.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|