C29H39NO11S2 — CID 176908993
methyl (2S,4S,5R,6R)-6-[(1R,2R)-3-benzylsulfonyloxy-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylate (PubChem CID 176908993) has the molecular formula C29H39NO11S2 and a molecular weight of 641.76 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-6-[(1R,2R)-3-benzylsulfonyloxy-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-6-[(1R,2R)-3-benzylsulfonyloxy-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylate |
|---|---|
| PubChem CID | 176908993 |
| Molecular Formula | C29H39NO11S2 |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | methyl (2S,4S,5R,6R)-6-[(1R,2R)-3-benzylsulfonyloxy-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(Sc2ccc(C)cc2)C[C@H](O)[C@@H](NC(=O)OC(C)(C)C)[C@H]([C@H](O)[C@H](O)COS(=O)(=O)Cc2ccccc2)O1 |
| InChI | InChI=1S/C29H39NO11S2/c1-18-11-13-20(14-12-18)42-29(26(34)38-5)15-21(31)23(30-27(35)41-28(2,3)4)25(40-29)24(33)22(32)16-39-43(36,37)17-19-9-7-6-8-10-19/h6-14,21-25,31-33H,15-17H2,1-5H3,(H,30,35)/t21-,22+,23+,24+,25+,29-/m0/s1 |
| InChIKey | HAUYHXNGBZCWKH-DUQDEQRNSA-N |
| XLogP | 2.27 |
| TPSA | 177.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|