C28H35NO13S — CID 11467742
methyl (2R,4S,5R,6R)-4-acetyloxy-5-(diacetylamino)-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 11467742) has the molecular formula C28H35NO13S and a molecular weight of 625.65 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4-acetyloxy-5-(diacetylamino)-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4-acetyloxy-5-(diacetylamino)-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11467742 |
| Molecular Formula | C28H35NO13S |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4-acetyloxy-5-(diacetylamino)-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H](OC(C)=O)[C@@H](N(C(C)=O)C(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C28H35NO13S/c1-15(30)29(16(2)31)24-22(39-18(4)33)13-28(27(36)37-7,43-21-11-9-8-10-12-21)42-26(24)25(41-20(6)35)23(40-19(5)34)14-38-17(3)32/h8-12,22-26H,13-14H2,1-7H3/t22-,23+,24+,25+,26+,28+/m0/s1 |
| InChIKey | KHUGKYDAPMVMNM-IHDDDBKGSA-N |
| XLogP | 1.56 |
| TPSA | 178.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|