C28H39FO11S — CID 102131690
methyl (2R,4S,5R,6S)-4-acetyloxy-2-(1-adamantylsulfanyl)-5-fluoro-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 102131690) has the molecular formula C28H39FO11S and a molecular weight of 602.67 g/mol. Its IUPAC name is methyl (2R,4S,5R,6S)-4-acetyloxy-2-(1-adamantylsulfanyl)-5-fluoro-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6S)-4-acetyloxy-2-(1-adamantylsulfanyl)-5-fluoro-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 102131690 |
| Molecular Formula | C28H39FO11S |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | methyl (2R,4S,5R,6S)-4-acetyloxy-2-(1-adamantylsulfanyl)-5-fluoro-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(SC23CC4CC(CC(C4)C2)C3)C[C@H](OC(C)=O)[C@@H](F)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C28H39FO11S/c1-14(30)36-13-22(38-16(3)32)24(39-17(4)33)25-23(29)21(37-15(2)31)12-28(40-25,26(34)35-5)41-27-9-18-6-19(10-27)8-20(7-18)11-27/h18-25H,6-13H2,1-5H3/t18?,19?,20?,21-,22+,23+,24+,25+,27?,28+/m0/s1 |
| InChIKey | HJWAEOCWOMFPMK-RGMRIWPQSA-N |
| XLogP | 3.04 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|