C17H21NO8S — CID 58153184
methyl (3aR,6R,7aR)-2-oxo-6-phenylsulfanyl-4-[(1R,2R)-1,2,3-trihydroxypropyl]-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate (PubChem CID 58153184) has the molecular formula C17H21NO8S and a molecular weight of 399.42 g/mol. Its IUPAC name is methyl (3aR,6R,7aR)-2-oxo-6-phenylsulfanyl-4-[(1R,2R)-1,2,3-trihydroxypropyl]-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (3aR,6R,7aR)-2-oxo-6-phenylsulfanyl-4-[(1R,2R)-1,2,3-trihydroxypropyl]-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 58153184 |
| Molecular Formula | C17H21NO8S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | methyl (3aR,6R,7aR)-2-oxo-6-phenylsulfanyl-4-[(1R,2R)-1,2,3-trihydroxypropyl]-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H]2OC(=O)N[C@H]2C([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C17H21NO8S/c1-24-15(22)17(27-9-5-3-2-4-6-9)7-11-12(18-16(23)25-11)14(26-17)13(21)10(20)8-19/h2-6,10-14,19-21H,7-8H2,1H3,(H,18,23)/t10-,11-,12-,13-,14?,17-/m1/s1 |
| InChIKey | PWTWMNLOCAQKPJ-CAWDYREWSA-N |
| XLogP | -0.37 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |