C29H34O15S — CID 139928831
[(2R,3S)-3-acetyloxy-3-[(2R,3R,4S,6R)-3,4-diacetyloxy-6-(hydroxymethyl)-6-phenylmethoxyoxan-2-yl]-2-sulfooxypropyl] benzoate (PubChem CID 139928831) has the molecular formula C29H34O15S and a molecular weight of 654.64 g/mol. Its IUPAC name is [(2R,3S)-3-acetyloxy-3-[(2R,3R,4S,6R)-3,4-diacetyloxy-6-(hydroxymethyl)-6-phenylmethoxyoxan-2-yl]-2-sulfooxypropyl] benzoate.
| Compound Name | [(2R,3S)-3-acetyloxy-3-[(2R,3R,4S,6R)-3,4-diacetyloxy-6-(hydroxymethyl)-6-phenylmethoxyoxan-2-yl]-2-sulfooxypropyl] benzoate |
|---|---|
| PubChem CID | 139928831 |
| Molecular Formula | C29H34O15S |
| Molecular Weight | 654.64 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | [(2R,3S)-3-acetyloxy-3-[(2R,3R,4S,6R)-3,4-diacetyloxy-6-(hydroxymethyl)-6-phenylmethoxyoxan-2-yl]-2-sulfooxypropyl] benzoate |
| SMILES | CC(=O)O[C@H]1[C@H]([C@H](OC(C)=O)[C@@H](COC(=O)c2ccccc2)OS(=O)(=O)O)O[C@](CO)(OCc2ccccc2)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H34O15S/c1-18(31)40-23-14-29(17-30,39-15-21-10-6-4-7-11-21)43-27(25(23)41-19(2)32)26(42-20(3)33)24(44-45(35,36)37)16-38-28(34)22-12-8-5-9-13-22/h4-13,23-27,30H,14-17H2,1-3H3,(H,35,36,37)/t23-,24+,25+,26+,27+,29+/m0/s1 |
| InChIKey | CYYABKHJWGCURR-VUKPHJNGSA-N |
| XLogP | 1.52 |
| TPSA | 207.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.64 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|