C22H30F2O8 — CID 157201381
methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4-methyl-5-(2-oxohex-5-ynyl)oxane-2-carboxylate (PubChem CID 157201381) has the molecular formula C22H30F2O8 and a molecular weight of 460.47 g/mol. Its IUPAC name is methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4-methyl-5-(2-oxohex-5-ynyl)oxane-2-carboxylate.
| Compound Name | methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4-methyl-5-(2-oxohex-5-ynyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 157201381 |
| Molecular Formula | C22H30F2O8 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | methyl 6-[(1R,2R)-1,2-diacetyloxybutyl]-2,3-difluoro-4-methyl-5-(2-oxohex-5-ynyl)oxane-2-carboxylate |
| SMILES | C#CCCC(=O)CC1C(C)C(F)C(F)(C(=O)OC)OC1[C@H](OC(C)=O)[C@@H](CC)OC(C)=O |
| InChI | InChI=1S/C22H30F2O8/c1-7-9-10-15(27)11-16-12(3)20(23)22(24,21(28)29-6)32-18(16)19(31-14(5)26)17(8-2)30-13(4)25/h1,12,16-20H,8-11H2,2-6H3/t12?,16?,17-,18?,19-,20?,22?/m1/s1 |
| InChIKey | WOZGIQMISAHNPH-CYFDIBNBSA-N |
| XLogP | 2.46 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|