C14H20F2N4O8 — CID 118287440
methyl 5-amino-4-azido-6-[(1S,2R)-1,2-diacetyloxy-3-hydroxypropyl]-2,3-difluorooxane-2-carboxylate (PubChem CID 118287440) has the molecular formula C14H20F2N4O8 and a molecular weight of 410.33 g/mol. Its IUPAC name is methyl 5-amino-4-azido-6-[(1S,2R)-1,2-diacetyloxy-3-hydroxypropyl]-2,3-difluorooxane-2-carboxylate.
| Compound Name | methyl 5-amino-4-azido-6-[(1S,2R)-1,2-diacetyloxy-3-hydroxypropyl]-2,3-difluorooxane-2-carboxylate |
|---|---|
| PubChem CID | 118287440 |
| Molecular Formula | C14H20F2N4O8 |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | methyl 5-amino-4-azido-6-[(1S,2R)-1,2-diacetyloxy-3-hydroxypropyl]-2,3-difluorooxane-2-carboxylate |
| SMILES | COC(=O)C1(F)OC([C@H](OC(C)=O)[C@@H](CO)OC(C)=O)C(N)C(N=[N+]=[N-])C1F |
| InChI | InChI=1S/C14H20F2N4O8/c1-5(22)26-7(4-21)10(27-6(2)23)11-8(17)9(19-20-18)12(15)14(16,28-11)13(24)25-3/h7-12,21H,4,17H2,1-3H3/t7-,8?,9?,10-,11?,12?,14?/m1/s1 |
| InChIKey | BUVAHUOABDWGEQ-OJUGJLEXSA-N |
| XLogP | -0.58 |
| TPSA | 183.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|