C15H20F2O8 — CID 157201377
2,3-difluoro-4-hydroxy-5-(2-oxohex-5-ynyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 157201377) has the molecular formula C15H20F2O8 and a molecular weight of 366.31 g/mol. Its IUPAC name is 2,3-difluoro-4-hydroxy-5-(2-oxohex-5-ynyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | 2,3-difluoro-4-hydroxy-5-(2-oxohex-5-ynyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 157201377 |
| Molecular Formula | C15H20F2O8 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2,3-difluoro-4-hydroxy-5-(2-oxohex-5-ynyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | C#CCCC(=O)CC1C(O)C(F)C(F)(C(=O)O)OC1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H20F2O8/c1-2-3-4-7(19)5-8-10(21)13(16)15(17,14(23)24)25-12(8)11(22)9(20)6-18/h1,8-13,18,20-22H,3-6H2,(H,23,24)/t8?,9-,10?,11-,12?,13?,15?/m1/s1 |
| InChIKey | YSCLABRBILVCJQ-NIUZZUGZSA-N |
| XLogP | -1.46 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|