C14H19FINO8 — CID 130409484
(2R,5R)-3-fluoro-4-hydroxy-2-iodo-5-(pent-4-ynoylamino)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 130409484) has the molecular formula C14H19FINO8 and a molecular weight of 475.21 g/mol. Its IUPAC name is (2R,5R)-3-fluoro-4-hydroxy-2-iodo-5-(pent-4-ynoylamino)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,5R)-3-fluoro-4-hydroxy-2-iodo-5-(pent-4-ynoylamino)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 130409484 |
| Molecular Formula | C14H19FINO8 |
| Molecular Weight | 475.21 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | (2R,5R)-3-fluoro-4-hydroxy-2-iodo-5-(pent-4-ynoylamino)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | C#CCCC(=O)N[C@@H]1C(O)C(F)[C@](I)(C(=O)O)OC1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H19FINO8/c1-2-3-4-7(20)17-8-10(22)12(15)14(16,13(23)24)25-11(8)9(21)6(19)5-18/h1,6,8-12,18-19,21-22H,3-5H2,(H,17,20)(H,23,24)/t6-,8-,9-,10?,11?,12?,14-/m1/s1 |
| InChIKey | AGYLWXBPFDXLIO-CYAHWWNLSA-N |
| XLogP | -2.09 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.21 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|