C15H21FO9 — CID 158618131
3-fluoro-2,4-dihydroxy-5-(2-oxohex-5-ynyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 158618131) has the molecular formula C15H21FO9 and a molecular weight of 364.32 g/mol. Its IUPAC name is 3-fluoro-2,4-dihydroxy-5-(2-oxohex-5-ynyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | 3-fluoro-2,4-dihydroxy-5-(2-oxohex-5-ynyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 158618131 |
| Molecular Formula | C15H21FO9 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-fluoro-2,4-dihydroxy-5-(2-oxohex-5-ynyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | C#CCCC(=O)CC1C(O)C(F)C(O)(C(=O)O)OC1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H21FO9/c1-2-3-4-7(18)5-8-10(20)13(16)15(24,14(22)23)25-12(8)11(21)9(19)6-17/h1,8-13,17,19-21,24H,3-6H2,(H,22,23)/t8?,9-,10?,11-,12?,13?,15?/m1/s1 |
| InChIKey | WCHBJUYCSMZCNJ-NIUZZUGZSA-N |
| XLogP | -2.44 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|