C9H15FO8 — CID 11207944
(2S,3R,4R,6R)-3-fluoro-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 11207944) has the molecular formula C9H15FO8 and a molecular weight of 270.21 g/mol. Its IUPAC name is (2S,3R,4R,6R)-3-fluoro-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2S,3R,4R,6R)-3-fluoro-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 11207944 |
| Molecular Formula | C9H15FO8 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2S,3R,4R,6R)-3-fluoro-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@]1(O)O[C@@H]([C@H](O)[C@H](O)CO)C[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C9H15FO8/c10-7-3(12)1-5(6(14)4(13)2-11)18-9(7,17)8(15)16/h3-7,11-14,17H,1-2H2,(H,15,16)/t3-,4-,5-,6-,7-,9-/m1/s1 |
| InChIKey | XKICCJJSXJDDQM-KTZFPWNASA-N |
| XLogP | -3.04 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |