C9H16O8S — CID 168824009
(2S,5R)-4,5-dihydroxy-2-sulfanyl-6-[(1R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 168824009) has the molecular formula C9H16O8S and a molecular weight of 284.29 g/mol. Its IUPAC name is (2S,5R)-4,5-dihydroxy-2-sulfanyl-6-[(1R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2S,5R)-4,5-dihydroxy-2-sulfanyl-6-[(1R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 168824009 |
| Molecular Formula | C9H16O8S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (2S,5R)-4,5-dihydroxy-2-sulfanyl-6-[(1R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@]1(S)CC(O)[C@@H](O)C([C@H](O)C(O)CO)O1 |
| InChI | InChI=1S/C9H16O8S/c10-2-4(12)6(14)7-5(13)3(11)1-9(18,17-7)8(15)16/h3-7,10-14,18H,1-2H2,(H,15,16)/t3?,4?,5-,6-,7?,9+/m1/s1 |
| InChIKey | ZVXJJPPINUOOJZ-JLMVBLEASA-N |
| XLogP | -3.08 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|