C11H18FNO8 — CID 156618840
(2R,3R,4R,5R,6R)-5-acetamido-6-[(1R)-1,3-dihydroxypropyl]-3-fluoro-2,4-dihydroxyoxane-2-carboxylic acid (PubChem CID 156618840) has the molecular formula C11H18FNO8 and a molecular weight of 311.26 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-5-acetamido-6-[(1R)-1,3-dihydroxypropyl]-3-fluoro-2,4-dihydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5R,6R)-5-acetamido-6-[(1R)-1,3-dihydroxypropyl]-3-fluoro-2,4-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 156618840 |
| Molecular Formula | C11H18FNO8 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (2R,3R,4R,5R,6R)-5-acetamido-6-[(1R)-1,3-dihydroxypropyl]-3-fluoro-2,4-dihydroxyoxane-2-carboxylic acid |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@@H](F)[C@@](O)(C(=O)O)O[C@H]1[C@H](O)CCO |
| InChI | InChI=1S/C11H18FNO8/c1-4(15)13-6-7(17)9(12)11(20,10(18)19)21-8(6)5(16)2-3-14/h5-9,14,16-17,20H,2-3H2,1H3,(H,13,15)(H,18,19)/t5-,6-,7-,8+,9-,11+/m1/s1 |
| InChIKey | YMMVWCIGTNHWMX-ATLLRHMBSA-N |
| XLogP | -2.89 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |