C19H23F2NO9 — CID 158126618
methyl 4-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-pent-4-ynoyloxymethyl]-6,7-difluoro-2-oxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate (PubChem CID 158126618) has the molecular formula C19H23F2NO9 and a molecular weight of 447.39 g/mol. Its IUPAC name is methyl 4-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-pent-4-ynoyloxymethyl]-6,7-difluoro-2-oxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate.
| Compound Name | methyl 4-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-pent-4-ynoyloxymethyl]-6,7-difluoro-2-oxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 158126618 |
| Molecular Formula | C19H23F2NO9 |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | methyl 4-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-pent-4-ynoyloxymethyl]-6,7-difluoro-2-oxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate |
| SMILES | C#CCCC(=O)O[C@@H](C1OC(F)(C(=O)OC)C(F)C2OC(=O)NC21)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H23F2NO9/c1-5-6-7-10(23)28-12(9-8-27-18(2,3)30-9)13-11-14(29-17(25)22-11)15(20)19(21,31-13)16(24)26-4/h1,9,11-15H,6-8H2,2-4H3,(H,22,25)/t9-,11?,12-,13?,14?,15?,19?/m1/s1 |
| InChIKey | FSGGRXQPNKCLMD-USNFKMPUSA-N |
| XLogP | 0.52 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|