C21H22F2N2O12 — CID 118300219
methyl 4-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-nitrophenoxy)carbonyloxymethyl]-6,7-difluoro-2-oxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate (PubChem CID 118300219) has the molecular formula C21H22F2N2O12 and a molecular weight of 532.41 g/mol. Its IUPAC name is methyl 4-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-nitrophenoxy)carbonyloxymethyl]-6,7-difluoro-2-oxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate.
| Compound Name | methyl 4-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-nitrophenoxy)carbonyloxymethyl]-6,7-difluoro-2-oxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 118300219 |
| Molecular Formula | C21H22F2N2O12 |
| Molecular Weight | 532.41 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | methyl 4-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-nitrophenoxy)carbonyloxymethyl]-6,7-difluoro-2-oxo-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)C1(F)OC([C@H](OC(=O)Oc2ccc([N+](=O)[O-])cc2)[C@H]2COC(C)(C)O2)C2NC(=O)OC2C1F |
| InChI | InChI=1S/C21H22F2N2O12/c1-20(2)32-8-11(36-20)13(35-19(28)33-10-6-4-9(5-7-10)25(29)30)14-12-15(34-18(27)24-12)16(22)21(23,37-14)17(26)31-3/h4-7,11-16H,8H2,1-3H3,(H,24,27)/t11-,12?,13-,14?,15?,16?,21?/m1/s1 |
| InChIKey | PAVAXXXMJZEPCD-AEYKDJFPSA-N |
| XLogP | 1.68 |
| TPSA | 170.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|