C22H26BN3O12 — CID 158308812
N-[1-[[(2R,3R,4R)-6-methoxycarbonyl-3-methyl-2-[(S)-(4-nitrophenoxy)carbonyloxy-[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran-4-yl]amino]ethylidene]-methylboronamidic acid (PubChem CID 158308812) has the molecular formula C22H26BN3O12 and a molecular weight of 535.27 g/mol. Its IUPAC name is N-[1-[[(2R,3R,4R)-6-methoxycarbonyl-3-methyl-2-[(S)-(4-nitrophenoxy)carbonyloxy-[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran-4-yl]amino]ethylidene]-methylboronamidic acid.
| Compound Name | N-[1-[[(2R,3R,4R)-6-methoxycarbonyl-3-methyl-2-[(S)-(4-nitrophenoxy)carbonyloxy-[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran-4-yl]amino]ethylidene]-methylboronamidic acid |
|---|---|
| PubChem CID | 158308812 |
| Molecular Formula | C22H26BN3O12 |
| Molecular Weight | 535.27 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | N-[1-[[(2R,3R,4R)-6-methoxycarbonyl-3-methyl-2-[(S)-(4-nitrophenoxy)carbonyloxy-[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran-4-yl]amino]ethylidene]-methylboronamidic acid |
| SMILES | COC(=O)C1=C[C@H](NC(C)=NB(C)O)[C@@H](C)[C@H]([C@H](OC(=O)Oc2ccc([N+](=O)[O-])cc2)[C@H]2COC(=O)O2)O1 |
| InChI | InChI=1S/C22H26BN3O12/c1-11-15(24-12(2)25-23(3)30)9-16(20(27)33-4)36-18(11)19(17-10-34-21(28)37-17)38-22(29)35-14-7-5-13(6-8-14)26(31)32/h5-9,11,15,17-19,30H,10H2,1-4H3,(H,24,25)/t11-,15+,17-,18-,19-/m1/s1 |
| InChIKey | RGYNFNVSYSETEG-WZDQYCNZSA-N |
| XLogP | 1.59 |
| TPSA | 194.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|