C20H22N2O12 — CID 142240212
methyl 3-acetamido-2-[3-carboxyoxy-1-(4-nitrophenoxy)carbonyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 142240212) has the molecular formula C20H22N2O12 and a molecular weight of 482.40 g/mol. Its IUPAC name is methyl 3-acetamido-2-[3-carboxyoxy-1-(4-nitrophenoxy)carbonyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl 3-acetamido-2-[3-carboxyoxy-1-(4-nitrophenoxy)carbonyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 142240212 |
| Molecular Formula | C20H22N2O12 |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | methyl 3-acetamido-2-[3-carboxyoxy-1-(4-nitrophenoxy)carbonyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=CCC(NC(C)=O)C(C(CCOC(=O)O)OC(=O)Oc2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C20H22N2O12/c1-11(23)21-14-7-8-16(18(24)30-2)33-17(14)15(9-10-31-19(25)26)34-20(27)32-13-5-3-12(4-6-13)22(28)29/h3-6,8,14-15,17H,7,9-10H2,1-2H3,(H,21,23)(H,25,26) |
| InChIKey | LVNMJEYQGCOTJK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 189.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|