C21H31N5O9 — CID 10601352
methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(S)-heptylcarbamoyloxy-[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 10601352) has the molecular formula C21H31N5O9 and a molecular weight of 497.51 g/mol. Its IUPAC name is methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(S)-heptylcarbamoyloxy-[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(S)-heptylcarbamoyloxy-[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 10601352 |
| Molecular Formula | C21H31N5O9 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(S)-heptylcarbamoyloxy-[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCCCCCCNC(=O)O[C@@H]([C@@H]1OC(C(=O)OC)=C[C@H](N=[N+]=[N-])[C@H]1NC(C)=O)[C@H]1COC(=O)O1 |
| InChI | InChI=1S/C21H31N5O9/c1-4-5-6-7-8-9-23-20(29)35-17(15-11-32-21(30)34-15)18-16(24-12(2)27)13(25-26-22)10-14(33-18)19(28)31-3/h10,13,15-18H,4-9,11H2,1-3H3,(H,23,29)(H,24,27)/t13-,15+,16+,17+,18+/m0/s1 |
| InChIKey | XLKMWVYHOGWTGT-CZIOMAOESA-N |
| XLogP | 2.23 |
| TPSA | 187.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|