C22H31N3O12 — CID 159256707
2-[(S)-[(2R,3R,4S)-3-acetamido-6-methoxycarbonyl-4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]-3,4-dihydro-2H-pyran-2-yl]-[(4R)-2-oxo-1,3-dioxolan-4-yl]methoxy]acetic acid (PubChem CID 159256707) has the molecular formula C22H31N3O12 and a molecular weight of 529.50 g/mol. Its IUPAC name is 2-[(S)-[(2R,3R,4S)-3-acetamido-6-methoxycarbonyl-4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]-3,4-dihydro-2H-pyran-2-yl]-[(4R)-2-oxo-1,3-dioxolan-4-yl]methoxy]acetic acid.
| Compound Name | 2-[(S)-[(2R,3R,4S)-3-acetamido-6-methoxycarbonyl-4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]-3,4-dihydro-2H-pyran-2-yl]-[(4R)-2-oxo-1,3-dioxolan-4-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 159256707 |
| Molecular Formula | C22H31N3O12 |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 2-[(S)-[(2R,3R,4S)-3-acetamido-6-methoxycarbonyl-4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]-3,4-dihydro-2H-pyran-2-yl]-[(4R)-2-oxo-1,3-dioxolan-4-yl]methoxy]acetic acid |
| SMILES | COC(=O)C1=C[C@H](/N=C(\C)NC(=O)OC(C)(C)C)[C@@H](NC(C)=O)[C@H]([C@H](OCC(=O)O)[C@H]2COC(=O)O2)O1 |
| InChI | InChI=1S/C22H31N3O12/c1-10(24-20(30)37-22(3,4)5)23-12-7-13(19(29)32-6)35-18(16(12)25-11(2)26)17(33-9-15(27)28)14-8-34-21(31)36-14/h7,12,14,16-18H,8-9H2,1-6H3,(H,25,26)(H,27,28)(H,23,24,30)/t12-,14+,16+,17+,18+/m0/s1 |
| InChIKey | GAJBGPGVQYXUJD-SEYFSXTGSA-N |
| XLogP | 0.26 |
| TPSA | 197.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|