C18H26N2O9S — CID 101237233
N-[[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-nitrobenzenesulfonamide (PubChem CID 101237233) has the molecular formula C18H26N2O9S and a molecular weight of 446.48 g/mol. Its IUPAC name is N-[[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 101237233 |
| Molecular Formula | C18H26N2O9S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-nitrobenzenesulfonamide |
| SMILES | CC1(C)OC[C@H]([C@@H](O)[C@@H]2OC(C)(C)O[C@@H]2CNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C18H26N2O9S/c1-17(2)26-10-14(28-17)15(21)16-13(27-18(3,4)29-16)9-19-30(24,25)12-7-5-11(6-8-12)20(22)23/h5-8,13-16,19,21H,9-10H2,1-4H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | WMIJIKZZQOZETG-KLHDSHLOSA-N |
| XLogP | 0.91 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|