C11H15NO6 — CID 10244169
methyl (1R,2S,6R,7S,8R)-4,4-dimethyl-10-oxo-3,5,9-trioxa-11-azatricyclo[6.3.0.02,6]undecane-7-carboxylate (PubChem CID 10244169) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is methyl (1R,2S,6R,7S,8R)-4,4-dimethyl-10-oxo-3,5,9-trioxa-11-azatricyclo[6.3.0.02,6]undecane-7-carboxylate.
| Compound Name | methyl (1R,2S,6R,7S,8R)-4,4-dimethyl-10-oxo-3,5,9-trioxa-11-azatricyclo[6.3.0.02,6]undecane-7-carboxylate |
|---|---|
| PubChem CID | 10244169 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | methyl (1R,2S,6R,7S,8R)-4,4-dimethyl-10-oxo-3,5,9-trioxa-11-azatricyclo[6.3.0.02,6]undecane-7-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2OC(=O)N[C@H]2[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C11H15NO6/c1-11(2)17-7-4(9(13)15-3)6-5(8(7)18-11)12-10(14)16-6/h4-8H,1-3H3,(H,12,14)/t4-,5+,6+,7+,8-/m0/s1 |
| InChIKey | KBSVKKDAMFJVQN-WCMLQCRESA-N |
| XLogP | -0.21 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |