C12H19NO5 — CID 42646423
(4R,5S)-4-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enyl-1,3-oxazolidin-2-one (PubChem CID 42646423) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is (4R,5S)-4-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 42646423 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (4R,5S)-4-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@@H]1OC(=O)N[C@H]1[C@@H]1OC(C)(C)O[C@@H]1CO |
| InChI | InChI=1S/C12H19NO5/c1-4-5-7-9(13-11(15)16-7)10-8(6-14)17-12(2,3)18-10/h4,7-10,14H,1,5-6H2,2-3H3,(H,13,15)/t7-,8+,9+,10+/m0/s1 |
| InChIKey | ORQZYABNFMPZIR-SGIHWFKDSA-N |
| XLogP | 0.55 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|