C9H15NO2 — CID 14023307
4-propan-2-yl-5-prop-2-enyl-1,3-oxazolidin-2-one (PubChem CID 14023307) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 4-propan-2-yl-5-prop-2-enyl-1,3-oxazolidin-2-one.
| Compound Name | 4-propan-2-yl-5-prop-2-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14023307 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 4-propan-2-yl-5-prop-2-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CCC1OC(=O)NC1C(C)C |
| InChI | InChI=1S/C9H15NO2/c1-4-5-7-8(6(2)3)10-9(11)12-7/h4,6-8H,1,5H2,2-3H3,(H,10,11) |
| InChIKey | RYBAKAACGGINQL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|