C14H15NO2 — CID 67112111
(4R,5R)-5-[(E)-2-phenylethenyl]-4-prop-2-enyl-1,3-oxazolidin-2-one (PubChem CID 67112111) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is (4R,5R)-5-[(E)-2-phenylethenyl]-4-prop-2-enyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-5-[(E)-2-phenylethenyl]-4-prop-2-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67112111 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (4R,5R)-5-[(E)-2-phenylethenyl]-4-prop-2-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H]1NC(=O)O[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H15NO2/c1-2-6-12-13(17-14(16)15-12)10-9-11-7-4-3-5-8-11/h2-5,7-10,12-13H,1,6H2,(H,15,16)/b10-9+/t12-,13-/m1/s1 |
| InChIKey | XDAMTKQGLYKNMU-WGVUZWOWSA-N |
| XLogP | 2.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|