C14H18N2 — CID 743025
(2S,3S)-2,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroquinoxaline (PubChem CID 743025) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | (2S,3S)-2,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 743025 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (2S,3S)-2,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroquinoxaline |
| SMILES | C=CC[C@@H]1Nc2ccccc2N[C@H]1CC=C |
| InChI | InChI=1S/C14H18N2/c1-3-7-11-12(8-4-2)16-14-10-6-5-9-13(14)15-11/h3-6,9-12,15-16H,1-2,7-8H2/t11-,12-/m0/s1 |
| InChIKey | MLKXLUABNFQTNB-RYUDHWBXSA-N |
| XLogP | 3.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|