C13H15NO — CID 54427704
3-ethyl-4-(2-phenylethenyl)azetidin-2-one (PubChem CID 54427704) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-ethyl-4-(2-phenylethenyl)azetidin-2-one.
| Compound Name | 3-ethyl-4-(2-phenylethenyl)azetidin-2-one |
|---|---|
| PubChem CID | 54427704 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-ethyl-4-(2-phenylethenyl)azetidin-2-one |
| SMILES | CCC1C(=O)NC1C=Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO/c1-2-11-12(14-13(11)15)9-8-10-6-4-3-5-7-10/h3-9,11-12H,2H2,1H3,(H,14,15) |
| InChIKey | WFHDMOCYIZPLGJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |