C17H25NO2Si — CID 53254254
(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-2-phenylethenyl]azetidin-2-one (PubChem CID 53254254) has the molecular formula C17H25NO2Si and a molecular weight of 303.48 g/mol. Its IUPAC name is (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-2-phenylethenyl]azetidin-2-one.
| Compound Name | (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-2-phenylethenyl]azetidin-2-one |
|---|---|
| PubChem CID | 53254254 |
| Molecular Formula | C17H25NO2Si |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-2-phenylethenyl]azetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)N[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H25NO2Si/c1-17(2,3)21(4,5)20-15-14(18-16(15)19)12-11-13-9-7-6-8-10-13/h6-12,14-15H,1-5H3,(H,18,19)/b12-11+/t14-,15+/m1/s1 |
| InChIKey | VKQXYRLFIRMAJV-BOXZDTQESA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|