C24H42O3Si2 — CID 11327996
(1R,2R,3R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-1,2,3,4-tetrahydronaphthalene-2-carbaldehyde (PubChem CID 11327996) has the molecular formula C24H42O3Si2 and a molecular weight of 434.77 g/mol. Its IUPAC name is (1R,2R,3R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-1,2,3,4-tetrahydronaphthalene-2-carbaldehyde.
| Compound Name | (1R,2R,3R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-1,2,3,4-tetrahydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 11327996 |
| Molecular Formula | C24H42O3Si2 |
| Molecular Weight | 434.77 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (1R,2R,3R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-1,2,3,4-tetrahydronaphthalene-2-carbaldehyde |
| SMILES | C[C@@H]1[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)c2ccccc2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42O3Si2/c1-17-20(16-25)22(27-29(10,11)24(5,6)7)19-15-13-12-14-18(19)21(17)26-28(8,9)23(2,3)4/h12-17,20-22H,1-11H3/t17-,20-,21+,22+/m1/s1 |
| InChIKey | LRRBKWGBCPCILP-GFRNBQLOSA-N |
| XLogP | 7.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.77 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|