C32H48O3Si2 — CID 101204672
tert-butyl-[[(1R,2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methoxyprop-1-ynyl)-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-dimethylsilane (PubChem CID 101204672) has the molecular formula C32H48O3Si2 and a molecular weight of 536.91 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methoxyprop-1-ynyl)-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methoxyprop-1-ynyl)-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101204672 |
| Molecular Formula | C32H48O3Si2 |
| Molecular Weight | 536.91 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | tert-butyl-[[(1R,2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-methoxyprop-1-ynyl)-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-dimethylsilane |
| SMILES | COCC#C[C@H]1[C@H](c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)c2ccccc2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H48O3Si2/c1-31(2,3)36(8,9)34-29-25-20-15-16-21-26(25)30(35-37(10,11)32(4,5)6)28(24-18-13-12-14-19-24)27(29)22-17-23-33-7/h12-16,18-21,27-30H,23H2,1-11H3/t27-,28-,29-,30+/m0/s1 |
| InChIKey | VDVGWQOYBYSPBM-GCXHJFECSA-N |
| XLogP | 8.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.91 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|