C27H42O5Si2 — CID 101011974
(4aR,9S,9aS,10R)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-4a,9,9a,10-tetrahydroanthracene-1,4-dione (PubChem CID 101011974) has the molecular formula C27H42O5Si2 and a molecular weight of 502.80 g/mol. Its IUPAC name is (4aR,9S,9aS,10R)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-4a,9,9a,10-tetrahydroanthracene-1,4-dione.
| Compound Name | (4aR,9S,9aS,10R)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-4a,9,9a,10-tetrahydroanthracene-1,4-dione |
|---|---|
| PubChem CID | 101011974 |
| Molecular Formula | C27H42O5Si2 |
| Molecular Weight | 502.80 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (4aR,9S,9aS,10R)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-4a,9,9a,10-tetrahydroanthracene-1,4-dione |
| SMILES | COc1cccc2c1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)C=CC(=O)[C@@H]1[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H42O5Si2/c1-26(2,3)33(8,9)31-24-17-13-12-14-20(30-7)21(17)25(32-34(10,11)27(4,5)6)23-19(29)16-15-18(28)22(23)24/h12-16,22-25H,1-11H3/t22-,23+,24+,25-/m0/s1 |
| InChIKey | AONINJWXPCPPQL-LIONHTAISA-N |
| XLogP | 6.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.80 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|