C22H27BrO2Si — CID 101262812
[(1R,2R)-2-(2-bromophenoxy)-1,2-dihydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101262812) has the molecular formula C22H27BrO2Si and a molecular weight of 431.45 g/mol. Its IUPAC name is [(1R,2R)-2-(2-bromophenoxy)-1,2-dihydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R)-2-(2-bromophenoxy)-1,2-dihydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101262812 |
| Molecular Formula | C22H27BrO2Si |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | [(1R,2R)-2-(2-bromophenoxy)-1,2-dihydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1c2ccccc2C=C[C@H]1Oc1ccccc1Br |
| InChI | InChI=1S/C22H27BrO2Si/c1-22(2,3)26(4,5)25-21-17-11-7-6-10-16(17)14-15-20(21)24-19-13-9-8-12-18(19)23/h6-15,20-21H,1-5H3/t20-,21-/m1/s1 |
| InChIKey | JJWPLWJZOVJLOV-NHCUHLMSSA-N |
| XLogP | 6.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|