C20H30O2Si — CID 11088836
tert-butyl-dimethyl-[(1R,2R)-2-[2-[(Z)-prop-1-enyl]phenoxy]cyclopent-3-en-1-yl]oxysilane (PubChem CID 11088836) has the molecular formula C20H30O2Si and a molecular weight of 330.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2R)-2-[2-[(Z)-prop-1-enyl]phenoxy]cyclopent-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,2R)-2-[2-[(Z)-prop-1-enyl]phenoxy]cyclopent-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 11088836 |
| Molecular Formula | C20H30O2Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2R)-2-[2-[(Z)-prop-1-enyl]phenoxy]cyclopent-3-en-1-yl]oxysilane |
| SMILES | C/C=C\c1ccccc1O[C@@H]1C=CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H30O2Si/c1-7-11-16-12-8-9-13-17(16)21-18-14-10-15-19(18)22-23(5,6)20(2,3)4/h7-14,18-19H,15H2,1-6H3/b11-7-/t18-,19-/m1/s1 |
| InChIKey | PWJCJTIQAYOKBE-OFIWPEFUSA-N |
| XLogP | 5.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|