About bis(2-prop-1-enylphenyl) sulfate
bis(2-prop-1-enylphenyl) sulfate (PubChem CID 54305499) has the molecular formula C18H18O4S
and a molecular weight of 330.41 g/mol. Its IUPAC name is bis(2-prop-1-enylphenyl) sulfate.
Molecular Properties
| Compound Name | bis(2-prop-1-enylphenyl) sulfate |
| PubChem CID | 54305499 |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | bis(2-prop-1-enylphenyl) sulfate |
| SMILES | CC=Cc1ccccc1OS(=O)(=O)Oc1ccccc1C=CC |
| InChI | InChI=1S/C18H18O4S/c1-3-9-15-11-5-7-13-17(15)21-23(19,20)22-18-14-8-6-12-16(18)10-4-2/h3-14H,1-2H3 |
| InChIKey | SHEYGOVZCIDOEH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-prop-1-enylphenyl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-prop-1-enylphenyl) sulfate?
The IUPAC name of bis(2-prop-1-enylphenyl) sulfate (CID 54305499) is bis(2-prop-1-enylphenyl) sulfate.
What is the SMILES notation for bis(2-prop-1-enylphenyl) sulfate?
The canonical SMILES for bis(2-prop-1-enylphenyl) sulfate is CC=Cc1ccccc1OS(=O)(=O)Oc1ccccc1C=CC.
What is the InChIKey of bis(2-prop-1-enylphenyl) sulfate?
The InChIKey is SHEYGOVZCIDOEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4S/c1-3-9-15-11-5-7-13-17(15)21-23(19,20)22-18-14-8-6-12-16(18)10-4-2/h3-14H,1-2H3.
What are the key properties of bis(2-prop-1-enylphenyl) sulfate?
bis(2-prop-1-enylphenyl) sulfate has a molecular weight of 330.41 g/mol, XLogP of 4.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-prop-1-enylphenyl) sulfate is sourced from PubChem (CID 54305499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).