About (2-prop-1-enylphenyl) sulfite
(2-prop-1-enylphenyl) sulfite (PubChem CID 175142928) has the molecular formula C9H9O3S-
and a molecular weight of 197.24 g/mol. Its IUPAC name is (2-prop-1-enylphenyl) sulfite.
Molecular Properties
| Compound Name | (2-prop-1-enylphenyl) sulfite |
| PubChem CID | 175142928 |
| Molecular Formula | C9H9O3S- |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | (2-prop-1-enylphenyl) sulfite |
| SMILES | CC=Cc1ccccc1OS(=O)[O-] |
| InChI | InChI=1S/C9H10O3S/c1-2-5-8-6-3-4-7-9(8)12-13(10)11/h2-7H,1H3,(H,10,11)/p-1 |
| InChIKey | WOTCGTYCAMXPNA-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2-prop-1-enylphenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-prop-1-enylphenyl) sulfite?
The IUPAC name of (2-prop-1-enylphenyl) sulfite (CID 175142928) is (2-prop-1-enylphenyl) sulfite.
What is the SMILES notation for (2-prop-1-enylphenyl) sulfite?
The canonical SMILES for (2-prop-1-enylphenyl) sulfite is CC=Cc1ccccc1OS(=O)[O-].
What is the InChIKey of (2-prop-1-enylphenyl) sulfite?
The InChIKey is WOTCGTYCAMXPNA-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O3S/c1-2-5-8-6-3-4-7-9(8)12-13(10)11/h2-7H,1H3,(H,10,11)/p-1.
What are the key properties of (2-prop-1-enylphenyl) sulfite?
(2-prop-1-enylphenyl) sulfite has a molecular weight of 197.24 g/mol, XLogP of 1.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-prop-1-enylphenyl) sulfite is sourced from PubChem (CID 175142928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).