About sodium (2-aminophenyl) sulfite
sodium (2-aminophenyl) sulfite (PubChem CID 156780353) has the molecular formula C6H6NNaO3S
and a molecular weight of 195.18 g/mol. Its IUPAC name is sodium (2-aminophenyl) sulfite.
Molecular Properties
| Compound Name | sodium (2-aminophenyl) sulfite |
| PubChem CID | 156780353 |
| Molecular Formula | C6H6NNaO3S |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | sodium (2-aminophenyl) sulfite |
| SMILES | Nc1ccccc1OS(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H7NO3S.Na/c7-5-3-1-2-4-6(5)10-11(8)9;/h1-4H,7H2,(H,8,9);/q;+1/p-1 |
| InChIKey | VLYKQFMUMZGFHT-UHFFFAOYSA-M |
| XLogP | -2.55 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium (2-aminophenyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (2-aminophenyl) sulfite?
The IUPAC name of sodium (2-aminophenyl) sulfite (CID 156780353) is sodium (2-aminophenyl) sulfite.
What is the SMILES notation for sodium (2-aminophenyl) sulfite?
The canonical SMILES for sodium (2-aminophenyl) sulfite is Nc1ccccc1OS(=O)[O-].[Na+].
What is the InChIKey of sodium (2-aminophenyl) sulfite?
The InChIKey is VLYKQFMUMZGFHT-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO3S.Na/c7-5-3-1-2-4-6(5)10-11(8)9;/h1-4H,7H2,(H,8,9);/q;+1/p-1.
What are the key properties of sodium (2-aminophenyl) sulfite?
sodium (2-aminophenyl) sulfite has a molecular weight of 195.18 g/mol, XLogP of -2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (2-aminophenyl) sulfite is sourced from PubChem (CID 156780353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).