C14H8NO5S- — CID 57176324
(4-amino-9,10-dioxoanthracen-1-yl) sulfite (PubChem CID 57176324) has the molecular formula C14H8NO5S- and a molecular weight of 302.29 g/mol. Its IUPAC name is (4-amino-9,10-dioxoanthracen-1-yl) sulfite.
| Compound Name | (4-amino-9,10-dioxoanthracen-1-yl) sulfite |
|---|---|
| PubChem CID | 57176324 |
| Molecular Formula | C14H8NO5S- |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | (4-amino-9,10-dioxoanthracen-1-yl) sulfite |
| SMILES | Nc1ccc(OS(=O)[O-])c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H9NO5S/c15-9-5-6-10(20-21(18)19)12-11(9)13(16)7-3-1-2-4-8(7)14(12)17/h1-6H,15H2,(H,18,19)/p-1 |
| InChIKey | HSNXNOLEMDIBDP-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|