C22H17NO4S — CID 15369749
1-amino-4-[(4-methylphenyl)sulfonylmethyl]anthracene-9,10-dione (PubChem CID 15369749) has the molecular formula C22H17NO4S and a molecular weight of 391.45 g/mol. Its IUPAC name is 1-amino-4-[(4-methylphenyl)sulfonylmethyl]anthracene-9,10-dione.
| Compound Name | 1-amino-4-[(4-methylphenyl)sulfonylmethyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 15369749 |
| Molecular Formula | C22H17NO4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-amino-4-[(4-methylphenyl)sulfonylmethyl]anthracene-9,10-dione |
| SMILES | Cc1ccc(S(=O)(=O)Cc2ccc(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H17NO4S/c1-13-6-9-15(10-7-13)28(26,27)12-14-8-11-18(23)20-19(14)21(24)16-4-2-3-5-17(16)22(20)25/h2-11H,12,23H2,1H3 |
| InChIKey | LLKMZIAGLNZAKY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|