C17H14N2O4S — CID 10382740
N-(3-amino-1,4-dioxonaphthalen-2-yl)-4-methylbenzenesulfonamide (PubChem CID 10382740) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is N-(3-amino-1,4-dioxonaphthalen-2-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(3-amino-1,4-dioxonaphthalen-2-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10382740 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(3-amino-1,4-dioxonaphthalen-2-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2=C(N)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H14N2O4S/c1-10-6-8-11(9-7-10)24(22,23)19-15-14(18)16(20)12-4-2-3-5-13(12)17(15)21/h2-9,19H,18H2,1H3 |
| InChIKey | FPKBXWUFXJORMD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|