C17H16O2S — CID 102313877
3-[(4-methylphenyl)sulfonylmethyl]-1H-indene (PubChem CID 102313877) has the molecular formula C17H16O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylmethyl]-1H-indene.
| Compound Name | 3-[(4-methylphenyl)sulfonylmethyl]-1H-indene |
|---|---|
| PubChem CID | 102313877 |
| Molecular Formula | C17H16O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylmethyl]-1H-indene |
| SMILES | Cc1ccc(S(=O)(=O)CC2=CCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H16O2S/c1-13-6-10-16(11-7-13)20(18,19)12-15-9-8-14-4-2-3-5-17(14)15/h2-7,9-11H,8,12H2,1H3 |
| InChIKey | XUCLXFMIZVNFTJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |