C36H32N2O6S2 — CID 161055965
4-[(4-methylphenyl)sulfonylmethyl]naphthalen-1-amine;1-[(4-methylphenyl)sulfonylmethyl]-4-nitronaphthalene (PubChem CID 161055965) has the molecular formula C36H32N2O6S2 and a molecular weight of 652.79 g/mol. Its IUPAC name is 4-[(4-methylphenyl)sulfonylmethyl]naphthalen-1-amine;1-[(4-methylphenyl)sulfonylmethyl]-4-nitronaphthalene.
| Compound Name | 4-[(4-methylphenyl)sulfonylmethyl]naphthalen-1-amine;1-[(4-methylphenyl)sulfonylmethyl]-4-nitronaphthalene |
|---|---|
| PubChem CID | 161055965 |
| Molecular Formula | C36H32N2O6S2 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.17 |
| IUPAC Name | 4-[(4-methylphenyl)sulfonylmethyl]naphthalen-1-amine;1-[(4-methylphenyl)sulfonylmethyl]-4-nitronaphthalene |
| SMILES | Cc1ccc(S(=O)(=O)Cc2ccc(N)c3ccccc23)cc1.Cc1ccc(S(=O)(=O)Cc2ccc([N+](=O)[O-])c3ccccc23)cc1 |
| InChI | InChI=1S/C18H15NO4S.C18H17NO2S/c1-13-6-9-15(10-7-13)24(22,23)12-14-8-11-18(19(20)21)17-5-3-2-4-16(14)17;1-13-6-9-15(10-7-13)22(20,21)12-14-8-11-18(19)17-5-3-2-4-16(14)17/h2-11H,12H2,1H3;2-11H,12,19H2,1H3 |
| InChIKey | UCTFQUXKRVEDTQ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|